C8H4Br2FN — CID 177254799
2,4-dibromo-6-fluoro-3-methylbenzonitrile (PubChem CID 177254799) has the molecular formula C8H4Br2FN and a molecular weight of 292.93 g/mol. Its IUPAC name is 2,4-dibromo-6-fluoro-3-methylbenzonitrile.
| Compound Name | 2,4-dibromo-6-fluoro-3-methylbenzonitrile |
|---|---|
| PubChem CID | 177254799 |
| Molecular Formula | C8H4Br2FN |
| Molecular Weight | 292.93 g/mol |
| Exact Mass | 290.87 |
| IUPAC Name | 2,4-dibromo-6-fluoro-3-methylbenzonitrile |
| SMILES | Cc1c(Br)cc(F)c(C#N)c1Br |
| InChI | InChI=1S/C8H4Br2FN/c1-4-6(9)2-7(11)5(3-12)8(4)10/h2H,1H3 |
| InChIKey | GUDGNMYUNTVBLE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.93 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |