About 3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione
3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione (PubChem CID 177255746) has the molecular formula C7H7N3OS
and a molecular weight of 181.22 g/mol. Its IUPAC name is 3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione.
Molecular Properties
| Compound Name | 3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione |
| PubChem CID | 177255746 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione |
| SMILES | S=C1NCC=CN1c1ccon1 |
| InChI | InChI=1S/C7H7N3OS/c12-7-8-3-1-4-10(7)6-2-5-11-9-6/h1-2,4-5H,3H2,(H,8,12) |
| InChIKey | KQDKYVMKINGXCU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione?
The IUPAC name of 3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione (CID 177255746) is 3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione.
What is the SMILES notation for 3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione?
The canonical SMILES for 3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione is S=C1NCC=CN1c1ccon1.
What is the InChIKey of 3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione?
The InChIKey is KQDKYVMKINGXCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3OS/c12-7-8-3-1-4-10(7)6-2-5-11-9-6/h1-2,4-5H,3H2,(H,8,12).
What are the key properties of 3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione?
3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione has a molecular weight of 181.22 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-oxazol-3-yl)-1,6-dihydropyrimidine-2-thione is sourced from PubChem (CID 177255746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).