C12H22O3 — CID 177255964
methyl (2R,3S)-3-ethyl-2-[(1S)-1-hydroxyethyl]-2,3-dimethylpent-4-enoate (PubChem CID 177255964) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is methyl (2R,3S)-3-ethyl-2-[(1S)-1-hydroxyethyl]-2,3-dimethylpent-4-enoate.
| Compound Name | methyl (2R,3S)-3-ethyl-2-[(1S)-1-hydroxyethyl]-2,3-dimethylpent-4-enoate |
|---|---|
| PubChem CID | 177255964 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | methyl (2R,3S)-3-ethyl-2-[(1S)-1-hydroxyethyl]-2,3-dimethylpent-4-enoate |
| SMILES | C=C[C@](C)(CC)[C@@](C)(C(=O)OC)[C@H](C)O |
| InChI | InChI=1S/C12H22O3/c1-7-11(4,8-2)12(5,9(3)13)10(14)15-6/h7,9,13H,1,8H2,2-6H3/t9-,11+,12+/m0/s1 |
| InChIKey | KMPADBSINURDLO-MVWJERBFSA-N |
| XLogP | 2.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|