C22H36N2O4P+ — CID 177256065
[2,4-bis[2-(hexylamino)-2-oxoethyl]phenyl]-hydroxy-oxophosphanium (PubChem CID 177256065) has the molecular formula C22H36N2O4P+ and a molecular weight of 423.51 g/mol. Its IUPAC name is [2,4-bis[2-(hexylamino)-2-oxoethyl]phenyl]-hydroxy-oxophosphanium.
| Compound Name | [2,4-bis[2-(hexylamino)-2-oxoethyl]phenyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 177256065 |
| Molecular Formula | C22H36N2O4P+ |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | [2,4-bis[2-(hexylamino)-2-oxoethyl]phenyl]-hydroxy-oxophosphanium |
| SMILES | CCCCCCNC(=O)Cc1ccc([P+](=O)O)c(CC(=O)NCCCCCC)c1 |
| InChI | InChI=1S/C22H35N2O4P/c1-3-5-7-9-13-23-21(25)16-18-11-12-20(29(27)28)19(15-18)17-22(26)24-14-10-8-6-4-2/h11-12,15H,3-10,13-14,16-17H2,1-2H3,(H2-,23,24,25,26,27,28)/p+1 |
| InChIKey | XIEMVKJBUCKFNT-UHFFFAOYSA-O |
| XLogP | 3.52 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|