About 8aH-azulene-1,1-dicarbonitrile
8aH-azulene-1,1-dicarbonitrile (PubChem CID 177256212) has the molecular formula C12H8N2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 8aH-azulene-1,1-dicarbonitrile.
Molecular Properties
| Compound Name | 8aH-azulene-1,1-dicarbonitrile |
| PubChem CID | 177256212 |
| Molecular Formula | C12H8N2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 8aH-azulene-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)C=CC2=CC=CC=CC21 |
| InChI | InChI=1S/C12H8N2/c13-8-12(9-14)7-6-10-4-2-1-3-5-11(10)12/h1-7,11H |
| InChIKey | CDGBFEQWFFJRDE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8aH-azulene-1,1-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8aH-azulene-1,1-dicarbonitrile?
The IUPAC name of 8aH-azulene-1,1-dicarbonitrile (CID 177256212) is 8aH-azulene-1,1-dicarbonitrile.
What is the SMILES notation for 8aH-azulene-1,1-dicarbonitrile?
The canonical SMILES for 8aH-azulene-1,1-dicarbonitrile is N#CC1(C#N)C=CC2=CC=CC=CC21.
What is the InChIKey of 8aH-azulene-1,1-dicarbonitrile?
The InChIKey is CDGBFEQWFFJRDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2/c13-8-12(9-14)7-6-10-4-2-1-3-5-11(10)12/h1-7,11H.
What are the key properties of 8aH-azulene-1,1-dicarbonitrile?
8aH-azulene-1,1-dicarbonitrile has a molecular weight of 180.21 g/mol, XLogP of 2.26, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8aH-azulene-1,1-dicarbonitrile is sourced from PubChem (CID 177256212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).