C23H38O6 — CID 177256818
(3R,5S,6S)-3,5-dimethyl-6-[(2R,4S,5R)-4-methyl-5-[(2S,5R)-2-methyl-5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]oxolan-2-yl]oxolan-2-yl]oxan-2-one (PubChem CID 177256818) has the molecular formula C23H38O6 and a molecular weight of 410.55 g/mol. Its IUPAC name is (3R,5S,6S)-3,5-dimethyl-6-[(2R,4S,5R)-4-methyl-5-[(2S,5R)-2-methyl-5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]oxolan-2-yl]oxolan-2-yl]oxan-2-one.
| Compound Name | (3R,5S,6S)-3,5-dimethyl-6-[(2R,4S,5R)-4-methyl-5-[(2S,5R)-2-methyl-5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]oxolan-2-yl]oxolan-2-yl]oxan-2-one |
|---|---|
| PubChem CID | 177256818 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | (3R,5S,6S)-3,5-dimethyl-6-[(2R,4S,5R)-4-methyl-5-[(2S,5R)-2-methyl-5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]oxolan-2-yl]oxolan-2-yl]oxan-2-one |
| SMILES | C[C@@H]1C[C@H](C)[C@@H]([C@H]2C[C@H](C)[C@H]([C@]3(C)CC[C@H]([C@]4(C)COC(C)(C)O4)O3)O2)OC1=O |
| InChI | InChI=1S/C23H38O6/c1-13-10-15(3)20(24)27-18(13)16-11-14(2)19(26-16)22(6)9-8-17(28-22)23(7)12-25-21(4,5)29-23/h13-19H,8-12H2,1-7H3/t13-,14-,15+,16+,17+,18-,19+,22-,23-/m0/s1 |
| InChIKey | LSAXMSQKTWOCRB-APSJMLFISA-N |
| XLogP | 3.85 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |