C28H26N2O8S — CID 177259718
5-[2-[(2R)-2-aminobut-3-enoyl]-1,3-dioxoinden-5-yl]sulfonyl-2-[(2R)-2-amino-4-methylpentanoyl]indene-1,3-dione (PubChem CID 177259718) has the molecular formula C28H26N2O8S and a molecular weight of 550.59 g/mol. Its IUPAC name is 5-[2-[(2R)-2-aminobut-3-enoyl]-1,3-dioxoinden-5-yl]sulfonyl-2-[(2R)-2-amino-4-methylpentanoyl]indene-1,3-dione.
| Compound Name | 5-[2-[(2R)-2-aminobut-3-enoyl]-1,3-dioxoinden-5-yl]sulfonyl-2-[(2R)-2-amino-4-methylpentanoyl]indene-1,3-dione |
|---|---|
| PubChem CID | 177259718 |
| Molecular Formula | C28H26N2O8S |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 5-[2-[(2R)-2-aminobut-3-enoyl]-1,3-dioxoinden-5-yl]sulfonyl-2-[(2R)-2-amino-4-methylpentanoyl]indene-1,3-dione |
| SMILES | C=C[C@@H](N)C(=O)C1C(=O)c2ccc(S(=O)(=O)c3ccc4c(c3)C(=O)C(C(=O)[C@H](N)CC(C)C)C4=O)cc2C1=O |
| InChI | InChI=1S/C28H26N2O8S/c1-4-19(29)27(35)21-23(31)15-7-5-13(10-17(15)25(21)33)39(37,38)14-6-8-16-18(11-14)26(34)22(24(16)32)28(36)20(30)9-12(2)3/h4-8,10-12,19-22H,1,9,29-30H2,2-3H3/t19-,20-,21?,22?/m1/s1 |
| InChIKey | XTSLQBNFHDKJOZ-JTVPBKEVSA-N |
| XLogP | 1.53 |
| TPSA | 188.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|