C25H32FN5O3 — CID 177260777
N-[(1E,3Z)-1-amino-4-cyclopropyl-5-iminopenta-1,3-dien-2-yl]-2-[(2S,5R)-2-(4-fluorophenyl)-5-methyl-4-(2-methylpropanoyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 177260777) has the molecular formula C25H32FN5O3 and a molecular weight of 469.56 g/mol. Its IUPAC name is N-[(1E,3Z)-1-amino-4-cyclopropyl-5-iminopenta-1,3-dien-2-yl]-2-[(2S,5R)-2-(4-fluorophenyl)-5-methyl-4-(2-methylpropanoyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-[(1E,3Z)-1-amino-4-cyclopropyl-5-iminopenta-1,3-dien-2-yl]-2-[(2S,5R)-2-(4-fluorophenyl)-5-methyl-4-(2-methylpropanoyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 177260777 |
| Molecular Formula | C25H32FN5O3 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N-[(1E,3Z)-1-amino-4-cyclopropyl-5-iminopenta-1,3-dien-2-yl]-2-[(2S,5R)-2-(4-fluorophenyl)-5-methyl-4-(2-methylpropanoyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | [H]/N=C/C(=C\C(=C/N)NC(=O)C(=O)N1C[C@@H](C)N(C(=O)C(C)C)C[C@@H]1c1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C25H32FN5O3/c1-15(2)24(33)30-14-22(18-6-8-20(26)9-7-18)31(13-16(30)3)25(34)23(32)29-21(12-28)10-19(11-27)17-4-5-17/h6-12,15-17,22,27H,4-5,13-14,28H2,1-3H3,(H,29,32)/b19-10+,21-12+,27-11+/t16-,22-/m1/s1 |
| InChIKey | BYRFXWQEXNRWEC-BFRBSVKISA-N |
| XLogP | 2.48 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|