C14H20FN3O8 — CID 177260973
2-(dimethylamino)ethyl 3-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidine-1-carboxylate (PubChem CID 177260973) has the molecular formula C14H20FN3O8 and a molecular weight of 377.33 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 3-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidine-1-carboxylate.
| Compound Name | 2-(dimethylamino)ethyl 3-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 177260973 |
| Molecular Formula | C14H20FN3O8 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-(dimethylamino)ethyl 3-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidine-1-carboxylate |
| SMILES | CN(C)CCOC(=O)n1c(=O)ccn([C@@H]2O[C@](F)(CO)[C@@H](O)[C@H]2O)c1=O |
| InChI | InChI=1S/C14H20FN3O8/c1-16(2)5-6-25-13(24)18-8(20)3-4-17(12(18)23)11-9(21)10(22)14(15,7-19)26-11/h3-4,9-11,19,21-22H,5-7H2,1-2H3/t9-,10+,11-,14-/m1/s1 |
| InChIKey | GQKNMDHVPBZEHF-FBKDDSFISA-N |
| XLogP | -2.54 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |