C15H12BrClN2O2 — CID 177261613
7-bromo-4-chloro-2-[(4-methoxyphenyl)methyl]-1H-pyrrolo[3,4-c]pyridin-3-one (PubChem CID 177261613) has the molecular formula C15H12BrClN2O2 and a molecular weight of 367.63 g/mol. Its IUPAC name is 7-bromo-4-chloro-2-[(4-methoxyphenyl)methyl]-1H-pyrrolo[3,4-c]pyridin-3-one.
| Compound Name | 7-bromo-4-chloro-2-[(4-methoxyphenyl)methyl]-1H-pyrrolo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 177261613 |
| Molecular Formula | C15H12BrClN2O2 |
| Molecular Weight | 367.63 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 7-bromo-4-chloro-2-[(4-methoxyphenyl)methyl]-1H-pyrrolo[3,4-c]pyridin-3-one |
| SMILES | COc1ccc(CN2Cc3c(Br)cnc(Cl)c3C2=O)cc1 |
| InChI | InChI=1S/C15H12BrClN2O2/c1-21-10-4-2-9(3-5-10)7-19-8-11-12(16)6-18-14(17)13(11)15(19)20/h2-6H,7-8H2,1H3 |
| InChIKey | LLHQUNQPAYQYJQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.63 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|