C11H19F3N2O — CID 177261770
(6R,7R)-6,7-dimethyl-8-(trifluoromethyl)-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-a][1,4]diazepine (PubChem CID 177261770) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is (6R,7R)-6,7-dimethyl-8-(trifluoromethyl)-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-a][1,4]diazepine.
| Compound Name | (6R,7R)-6,7-dimethyl-8-(trifluoromethyl)-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-a][1,4]diazepine |
|---|---|
| PubChem CID | 177261770 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (6R,7R)-6,7-dimethyl-8-(trifluoromethyl)-3,4,6,7,8,9,10,10a-octahydro-1H-[1,4]oxazino[4,3-a][1,4]diazepine |
| SMILES | C[C@@H]1C(C(F)(F)F)NCC2COCCN2[C@@H]1C |
| InChI | InChI=1S/C11H19F3N2O/c1-7-8(2)16-3-4-17-6-9(16)5-15-10(7)11(12,13)14/h7-10,15H,3-6H2,1-2H3/t7-,8+,9?,10?/m0/s1 |
| InChIKey | WYBGIJQRUANGKF-AFWXGSBKSA-N |
| XLogP | 1.25 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |