C25H21FN6O3 — CID 177262026
7-[[(10R)-8,12-dioxa-1,6-diazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]amino]-4-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-2,3-dihydroisoindol-1-one (PubChem CID 177262026) has the molecular formula C25H21FN6O3 and a molecular weight of 472.48 g/mol. Its IUPAC name is 7-[[(10R)-8,12-dioxa-1,6-diazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]amino]-4-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-2,3-dihydroisoindol-1-one.
| Compound Name | 7-[[(10R)-8,12-dioxa-1,6-diazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]amino]-4-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 177262026 |
| Molecular Formula | C25H21FN6O3 |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 7-[[(10R)-8,12-dioxa-1,6-diazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]amino]-4-(7-fluoroimidazo[1,2-a]pyridin-3-yl)-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2c(-c3cnc4cc(F)ccn34)ccc(Nc3ccc4c(n3)OC[C@H]3COCCN43)c21 |
| InChI | InChI=1S/C25H21FN6O3/c26-14-5-6-32-20(11-27-22(32)9-14)16-1-2-18(23-17(16)10-28-24(23)33)29-21-4-3-19-25(30-21)35-13-15-12-34-8-7-31(15)19/h1-6,9,11,15H,7-8,10,12-13H2,(H,28,33)(H,29,30)/t15-/m1/s1 |
| InChIKey | HGNARJFKBILTIL-OAHLLOKOSA-N |
| XLogP | 3.12 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |