C20H25BN2O5 — CID 177263005
(3R)-4,4,5,5-tetradeuterio-3-hydroxy-1-methyl-3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-oxazol-5-yl]pyrrolidin-2-one (PubChem CID 177263005) has the molecular formula C20H25BN2O5 and a molecular weight of 388.27 g/mol. Its IUPAC name is (3R)-4,4,5,5-tetradeuterio-3-hydroxy-1-methyl-3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-oxazol-5-yl]pyrrolidin-2-one.
| Compound Name | (3R)-4,4,5,5-tetradeuterio-3-hydroxy-1-methyl-3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-oxazol-5-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 177263005 |
| Molecular Formula | C20H25BN2O5 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (3R)-4,4,5,5-tetradeuterio-3-hydroxy-1-methyl-3-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-oxazol-5-yl]pyrrolidin-2-one |
| SMILES | [2H]C1([2H])N(C)C(=O)[C@](O)(c2cc(-c3cccc(B4OC(C)(C)C(C)(C)O4)c3)no2)C1([2H])[2H] |
| InChI | InChI=1S/C20H25BN2O5/c1-18(2)19(3,4)28-21(27-18)14-8-6-7-13(11-14)15-12-16(26-22-15)20(25)9-10-23(5)17(20)24/h6-8,11-12,25H,9-10H2,1-5H3/t20-/m1/s1/i9D2,10D2 |
| InChIKey | NYJMWDUFPXTUKW-NLTXWSMSSA-N |
| XLogP | 1.69 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|