C10H16F2N2O — CID 177263183
4-tert-butyl-1-(2,2-difluoroethyl)-3-methoxypyrazole (PubChem CID 177263183) has the molecular formula C10H16F2N2O and a molecular weight of 218.25 g/mol. Its IUPAC name is 4-tert-butyl-1-(2,2-difluoroethyl)-3-methoxypyrazole.
| Compound Name | 4-tert-butyl-1-(2,2-difluoroethyl)-3-methoxypyrazole |
|---|---|
| PubChem CID | 177263183 |
| Molecular Formula | C10H16F2N2O |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-tert-butyl-1-(2,2-difluoroethyl)-3-methoxypyrazole |
| SMILES | COc1nn(CC(F)F)cc1C(C)(C)C |
| InChI | InChI=1S/C10H16F2N2O/c1-10(2,3)7-5-14(6-8(11)12)13-9(7)15-4/h5,8H,6H2,1-4H3 |
| InChIKey | JDQDNWMRRYNGMB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |