C29H37P — CID 177264764
3-[2,6-di(propan-2-yl)phenyl]-2,2,4,4,6-pentamethyl-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (PubChem CID 177264764) has the molecular formula C29H37P and a molecular weight of 416.59 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-2,2,4,4,6-pentamethyl-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene.
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-2,2,4,4,6-pentamethyl-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
|---|---|
| PubChem CID | 177264764 |
| Molecular Formula | C29H37P |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-2,2,4,4,6-pentamethyl-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| SMILES | Cc1ccc2cccc3c2c1C(C)(C)P(c1c(C(C)C)cccc1C(C)C)C3(C)C |
| InChI | InChI=1S/C29H37P/c1-18(2)22-13-11-14-23(19(3)4)27(22)30-28(6,7)24-15-10-12-21-17-16-20(5)26(25(21)24)29(30,8)9/h10-19H,1-9H3 |
| InChIKey | FESXWVGYEQWUNE-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|