About [2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate
[2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate (PubChem CID 177265976) has the molecular formula C22H22O3
and a molecular weight of 334.42 g/mol. Its IUPAC name is [2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate.
Molecular Properties
| Compound Name | [2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate |
| PubChem CID | 177265976 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | [2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)OC2(c3cccc(O)c3)CC3CCC2C3)cc1 |
| InChI | InChI=1S/C22H22O3/c1-2-15-6-9-17(10-7-15)21(24)25-22(14-16-8-11-19(22)12-16)18-4-3-5-20(23)13-18/h2-7,9-10,13,16,19,23H,1,8,11-12,14H2 |
| InChIKey | KCKULIACVQHEGS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate?
The IUPAC name of [2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate (CID 177265976) is [2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate.
What is the SMILES notation for [2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate?
The canonical SMILES for [2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate is C=Cc1ccc(C(=O)OC2(c3cccc(O)c3)CC3CCC2C3)cc1.
What is the InChIKey of [2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate?
The InChIKey is KCKULIACVQHEGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O3/c1-2-15-6-9-17(10-7-15)21(24)25-22(14-16-8-11-19(22)12-16)18-4-3-5-20(23)13-18/h2-7,9-10,13,16,19,23H,1,8,11-12,14H2.
What are the key properties of [2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate?
[2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate has a molecular weight of 334.42 g/mol, XLogP of 4.91, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-hydroxyphenyl)-2-bicyclo[2.2.1]heptanyl] 4-ethenylbenzoate is sourced from PubChem (CID 177265976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).