C27H26BrFO2SSi — CID 177266090
[2-(4-bromophenyl)-6-[tert-butyl(dimethyl)silyl]oxy-1-benzothiophen-3-yl]-(4-fluorophenyl)methanone (PubChem CID 177266090) has the molecular formula C27H26BrFO2SSi and a molecular weight of 541.56 g/mol. Its IUPAC name is [2-(4-bromophenyl)-6-[tert-butyl(dimethyl)silyl]oxy-1-benzothiophen-3-yl]-(4-fluorophenyl)methanone.
| Compound Name | [2-(4-bromophenyl)-6-[tert-butyl(dimethyl)silyl]oxy-1-benzothiophen-3-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 177266090 |
| Molecular Formula | C27H26BrFO2SSi |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 540.06 |
| IUPAC Name | [2-(4-bromophenyl)-6-[tert-butyl(dimethyl)silyl]oxy-1-benzothiophen-3-yl]-(4-fluorophenyl)methanone |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(C(=O)c3ccc(F)cc3)c(-c3ccc(Br)cc3)sc2c1 |
| InChI | InChI=1S/C27H26BrFO2SSi/c1-27(2,3)33(4,5)31-21-14-15-22-23(16-21)32-26(18-6-10-19(28)11-7-18)24(22)25(30)17-8-12-20(29)13-9-17/h6-16H,1-5H3 |
| InChIKey | ARFAOMWRHYWKSN-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|