C27H23F3O3 — CID 177266119
4-methyl-6-(oxan-2-yloxy)-2-phenyl-3-(2,4,6-trifluorophenyl)-2H-chromene (PubChem CID 177266119) has the molecular formula C27H23F3O3 and a molecular weight of 452.47 g/mol. Its IUPAC name is 4-methyl-6-(oxan-2-yloxy)-2-phenyl-3-(2,4,6-trifluorophenyl)-2H-chromene.
| Compound Name | 4-methyl-6-(oxan-2-yloxy)-2-phenyl-3-(2,4,6-trifluorophenyl)-2H-chromene |
|---|---|
| PubChem CID | 177266119 |
| Molecular Formula | C27H23F3O3 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 4-methyl-6-(oxan-2-yloxy)-2-phenyl-3-(2,4,6-trifluorophenyl)-2H-chromene |
| SMILES | CC1=C(c2c(F)cc(F)cc2F)C(c2ccccc2)Oc2ccc(OC3CCCCO3)cc21 |
| InChI | InChI=1S/C27H23F3O3/c1-16-20-15-19(32-24-9-5-6-12-31-24)10-11-23(20)33-27(17-7-3-2-4-8-17)25(16)26-21(29)13-18(28)14-22(26)30/h2-4,7-8,10-11,13-15,24,27H,5-6,9,12H2,1H3 |
| InChIKey | VBJQMLYOVLGULI-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|