About 2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine
2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine (PubChem CID 177267270) has the molecular formula C15H23N3
and a molecular weight of 245.37 g/mol. Its IUPAC name is 2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine |
| PubChem CID | 177267270 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine |
| SMILES | CC(C)(C)C1=CN2N=C(C(C)(C)C)C=CC2C=N1 |
| InChI | InChI=1S/C15H23N3/c1-14(2,3)12-8-7-11-9-16-13(15(4,5)6)10-18(11)17-12/h7-11H,1-6H3 |
| InChIKey | VXQUPQAPWMDRDK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine?
The IUPAC name of 2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine (CID 177267270) is 2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine.
What is the SMILES notation for 2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine?
The canonical SMILES for 2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine is CC(C)(C)C1=CN2N=C(C(C)(C)C)C=CC2C=N1.
What is the InChIKey of 2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine?
The InChIKey is VXQUPQAPWMDRDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3/c1-14(2,3)12-8-7-11-9-16-13(15(4,5)6)10-18(11)17-12/h7-11H,1-6H3.
What are the key properties of 2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine?
2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine has a molecular weight of 245.37 g/mol, XLogP of 3.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-ditert-butyl-4aH-pyrazino[1,2-b]pyridazine is sourced from PubChem (CID 177267270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).