C17H19BrFN3O — CID 177267715
6-[(4-bromo-2-fluorophenoxy)methyl]-N-piperidin-4-ylpyridin-2-amine (PubChem CID 177267715) has the molecular formula C17H19BrFN3O and a molecular weight of 380.26 g/mol. Its IUPAC name is 6-[(4-bromo-2-fluorophenoxy)methyl]-N-piperidin-4-ylpyridin-2-amine.
| Compound Name | 6-[(4-bromo-2-fluorophenoxy)methyl]-N-piperidin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 177267715 |
| Molecular Formula | C17H19BrFN3O |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 6-[(4-bromo-2-fluorophenoxy)methyl]-N-piperidin-4-ylpyridin-2-amine |
| SMILES | Fc1cc(Br)ccc1OCc1cccc(NC2CCNCC2)n1 |
| InChI | InChI=1S/C17H19BrFN3O/c18-12-4-5-16(15(19)10-12)23-11-14-2-1-3-17(22-14)21-13-6-8-20-9-7-13/h1-5,10,13,20H,6-9,11H2,(H,21,22) |
| InChIKey | KYRVXPJMGOORHO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |