About (E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal
(E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal (PubChem CID 177269516) has the molecular formula C28H58O3Si2
and a molecular weight of 498.94 g/mol. Its IUPAC name is (E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal.
Molecular Properties
| Compound Name | (E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal |
| PubChem CID | 177269516 |
| Molecular Formula | C28H58O3Si2 |
| Molecular Weight | 498.94 g/mol |
| Exact Mass | 498.39 |
| IUPAC Name | (E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal |
| SMILES | CCCCCC(O[Si](C(C)C)(C(C)C)C(C)C)C(/C=C/C=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H58O3Si2/c1-14-15-16-18-27(30-32(21(2)3,22(4)5)23(6)7)28(19-17-20-29)31-33(24(8)9,25(10)11)26(12)13/h17,19-28H,14-16,18H2,1-13H3/b19-17+ |
| InChIKey | WGCUJCCUOWOTMP-HTXNQAPBSA-N |
| XLogP | 9.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.94 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal?
The IUPAC name of (E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal (CID 177269516) is (E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal.
What is the SMILES notation for (E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal?
The canonical SMILES for (E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal is CCCCCC(O[Si](C(C)C)(C(C)C)C(C)C)C(/C=C/C=O)O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal?
The InChIKey is WGCUJCCUOWOTMP-HTXNQAPBSA-N. The full InChI is InChI=1S/C28H58O3Si2/c1-14-15-16-18-27(30-32(21(2)3,22(4)5)23(6)7)28(19-17-20-29)31-33(24(8)9,25(10)11)26(12)13/h17,19-28H,14-16,18H2,1-13H3/b19-17+.
What are the key properties of (E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal?
(E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal has a molecular weight of 498.94 g/mol, XLogP of 9.44, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,5-bis[tri(propan-2-yl)silyloxy]dec-2-enal is sourced from PubChem (CID 177269516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).