C13H20N4O6 — CID 177270682
9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1,7-dimethyl-3,8-dihydropurine-2,6-dione (PubChem CID 177270682) has the molecular formula C13H20N4O6 and a molecular weight of 328.33 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1,7-dimethyl-3,8-dihydropurine-2,6-dione.
| Compound Name | 9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1,7-dimethyl-3,8-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 177270682 |
| Molecular Formula | C13H20N4O6 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1,7-dimethyl-3,8-dihydropurine-2,6-dione |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1CN(C)c2c1[nH]c(=O)n(C)c2=O |
| InChI | InChI=1S/C13H20N4O6/c1-15-5-17(10-7(15)11(20)16(2)13(21)14-10)12-9(22-3)8(19)6(4-18)23-12/h6,8-9,12,18-19H,4-5H2,1-3H3,(H,14,21)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | VPDFGOCNRCNUJR-WOUKDFQISA-N |
| XLogP | -2.62 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |