C54H32O — CID 177271207
10-[1,2,3,4,5,6,7,8-octadeuterio-10-(9-naphthalen-1-ylphenanthren-3-yl)anthracen-9-yl]naphtho[1,2-b][1]benzofuran (PubChem CID 177271207) has the molecular formula C54H32O and a molecular weight of 704.90 g/mol. Its IUPAC name is 10-[1,2,3,4,5,6,7,8-octadeuterio-10-(9-naphthalen-1-ylphenanthren-3-yl)anthracen-9-yl]naphtho[1,2-b][1]benzofuran.
| Compound Name | 10-[1,2,3,4,5,6,7,8-octadeuterio-10-(9-naphthalen-1-ylphenanthren-3-yl)anthracen-9-yl]naphtho[1,2-b][1]benzofuran |
|---|---|
| PubChem CID | 177271207 |
| Molecular Formula | C54H32O |
| Molecular Weight | 704.90 g/mol |
| Exact Mass | 704.30 |
| IUPAC Name | 10-[1,2,3,4,5,6,7,8-octadeuterio-10-(9-naphthalen-1-ylphenanthren-3-yl)anthracen-9-yl]naphtho[1,2-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc4c3oc3c5ccccc5ccc43)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc4cc(-c5cccc6ccccc56)c5ccccc5c4c3)c2c1[2H] |
| InChI | InChI=1S/C54H32O/c1-3-16-37-33(13-1)15-11-24-39(37)50-31-35-27-28-36(32-49(35)40-18-5-6-19-41(40)50)51-42-20-7-9-22-44(42)52(45-23-10-8-21-43(45)51)48-26-12-25-46-47-30-29-34-14-2-4-17-38(34)53(47)55-54(46)48/h1-32H/i7D,8D,9D,10D,20D,21D,22D,23D |
| InChIKey | QGNWJZGEQREVPM-REHAHKLHSA-N |
| XLogP | 15.51 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.90 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|