C21H23F4N3O4 — CID 177272969
2-[2-(2,2-difluoroethoxy)ethyl]-N-[(3R)-6-(2,2-difluoroethyl)-3,4-dihydro-2H-chromen-3-yl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxamide (PubChem CID 177272969) has the molecular formula C21H23F4N3O4 and a molecular weight of 457.42 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-N-[(3R)-6-(2,2-difluoroethyl)-3,4-dihydro-2H-chromen-3-yl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxamide.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-N-[(3R)-6-(2,2-difluoroethyl)-3,4-dihydro-2H-chromen-3-yl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxamide |
|---|---|
| PubChem CID | 177272969 |
| Molecular Formula | C21H23F4N3O4 |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-N-[(3R)-6-(2,2-difluoroethyl)-3,4-dihydro-2H-chromen-3-yl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxamide |
| SMILES | O=C(N[C@H]1COc2ccc(CC(F)F)cc2C1)c1cc2n(n1)CC(CCOCC(F)F)O2 |
| InChI | InChI=1S/C21H23F4N3O4/c22-18(23)6-12-1-2-17-13(5-12)7-14(10-31-17)26-21(29)16-8-20-28(27-16)9-15(32-20)3-4-30-11-19(24)25/h1-2,5,8,14-15,18-19H,3-4,6-7,9-11H2,(H,26,29)/t14-,15?/m1/s1 |
| InChIKey | QRIUOIZMQKEBCL-GICMACPYSA-N |
| XLogP | 2.86 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|