About 1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium)
1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium) (PubChem CID 177274101) has the molecular formula C13H24O5Rf2-4
and a molecular weight of 794.33 g/mol. Its IUPAC name is 1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium).
Molecular Properties
| Compound Name | 1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium) |
| PubChem CID | 177274101 |
| Molecular Formula | C13H24O5Rf2-4 |
| Molecular Weight | 794.33 g/mol |
| Exact Mass | 794.41 |
| IUPAC Name | 1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium) |
| SMILES | C=CCO[CH2-].C=CCO[CH2-].[CH2-]OCC(O)CO[CH2-].[Rf].[Rf] |
| InChI | InChI=1S/C5H10O3.2C4H7O.2Rf/c1-7-3-5(6)4-8-2;2*1-3-4-5-2;;/h5-6H,1-4H2;2*3H,1-2,4H2;;/q-2;2*-1;; |
| InChIKey | MRGFNPDCKAUQDK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 794.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium)?
The IUPAC name of 1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium) (CID 177274101) is 1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium).
What is the SMILES notation for 1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium)?
The canonical SMILES for 1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium) is C=CCO[CH2-].C=CCO[CH2-].[CH2-]OCC(O)CO[CH2-].[Rf].[Rf].
What is the InChIKey of 1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium)?
The InChIKey is MRGFNPDCKAUQDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.2C4H7O.2Rf/c1-7-3-5(6)4-8-2;2*1-3-4-5-2;;/h5-6H,1-4H2;2*3H,1-2,4H2;;/q-2;2*-1;;.
What are the key properties of 1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium)?
1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium) has a molecular weight of 794.33 g/mol, XLogP of 1.92, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethanidyloxypropan-2-ol;bis(3-methanidyloxyprop-1-ene);bis(rutherfordium) is sourced from PubChem (CID 177274101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).