About 1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine
1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine (PubChem CID 177274253) has the molecular formula C13H19FN2
and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine |
| PubChem CID | 177274253 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine |
| SMILES | Cc1ccc(N2CCN(C)CC2C)c(F)c1 |
| InChI | InChI=1S/C13H19FN2/c1-10-4-5-13(12(14)8-10)16-7-6-15(3)9-11(16)2/h4-5,8,11H,6-7,9H2,1-3H3 |
| InChIKey | GCPAFAXDPJILQT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine?
The IUPAC name of 1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine (CID 177274253) is 1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine.
What is the SMILES notation for 1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine?
The canonical SMILES for 1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine is Cc1ccc(N2CCN(C)CC2C)c(F)c1.
What is the InChIKey of 1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine?
The InChIKey is GCPAFAXDPJILQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19FN2/c1-10-4-5-13(12(14)8-10)16-7-6-15(3)9-11(16)2/h4-5,8,11H,6-7,9H2,1-3H3.
What are the key properties of 1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine?
1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine has a molecular weight of 222.31 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoro-4-methylphenyl)-2,4-dimethylpiperazine is sourced from PubChem (CID 177274253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).