C17H24FN3O4 — CID 177274351
tert-butyl (2R)-4-(2-fluoro-6-methoxycarbonyl-3-pyridinyl)-2-methylpiperazine-1-carboxylate (PubChem CID 177274351) has the molecular formula C17H24FN3O4 and a molecular weight of 353.39 g/mol. Its IUPAC name is tert-butyl (2R)-4-(2-fluoro-6-methoxycarbonyl-3-pyridinyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-(2-fluoro-6-methoxycarbonyl-3-pyridinyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 177274351 |
| Molecular Formula | C17H24FN3O4 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | tert-butyl (2R)-4-(2-fluoro-6-methoxycarbonyl-3-pyridinyl)-2-methylpiperazine-1-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)[C@H](C)C2)c(F)n1 |
| InChI | InChI=1S/C17H24FN3O4/c1-11-10-20(8-9-21(11)16(23)25-17(2,3)4)13-7-6-12(15(22)24-5)19-14(13)18/h6-7,11H,8-10H2,1-5H3/t11-/m1/s1 |
| InChIKey | MIBUNRSBKYZKSI-LLVKDONJSA-N |
| XLogP | 2.45 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|