About (4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one
(4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one (PubChem CID 177276648) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is (4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one.
Molecular Properties
| Compound Name | (4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one |
| PubChem CID | 177276648 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | (4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one |
| SMILES | C=CCC[C@H](NC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C14H27NO/c1-8-9-10-11(15-14(5,6)7)12(16)13(2,3)4/h8,11,15H,1,9-10H2,2-7H3/t11-/m0/s1 |
| InChIKey | HZUGSJAFGLWJAH-NSHDSACASA-N |
| XLogP | 3.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one?
The IUPAC name of (4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one (CID 177276648) is (4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one.
What is the SMILES notation for (4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one?
The canonical SMILES for (4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one is C=CCC[C@H](NC(C)(C)C)C(=O)C(C)(C)C.
What is the InChIKey of (4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one?
The InChIKey is HZUGSJAFGLWJAH-NSHDSACASA-N. The full InChI is InChI=1S/C14H27NO/c1-8-9-10-11(15-14(5,6)7)12(16)13(2,3)4/h8,11,15H,1,9-10H2,2-7H3/t11-/m0/s1.
What are the key properties of (4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one?
(4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one has a molecular weight of 225.38 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(tert-butylamino)-2,2-dimethyloct-7-en-3-one is sourced from PubChem (CID 177276648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).