C28H39N7O9 — CID 177277874
[1-[2-[[2-[[2-[(2-azidoacetyl)amino]acetyl]amino]acetyl]-methylamino]ethyl-methylcarbamoyl]oxy-5-hydroxy-2,5,7-trimethyl-4-oxospiro[1H-indene-6,1'-cyclopropane]-2-yl]methyl acetate (PubChem CID 177277874) has the molecular formula C28H39N7O9 and a molecular weight of 617.66 g/mol. Its IUPAC name is [1-[2-[[2-[[2-[(2-azidoacetyl)amino]acetyl]amino]acetyl]-methylamino]ethyl-methylcarbamoyl]oxy-5-hydroxy-2,5,7-trimethyl-4-oxospiro[1H-indene-6,1'-cyclopropane]-2-yl]methyl acetate.
| Compound Name | [1-[2-[[2-[[2-[(2-azidoacetyl)amino]acetyl]amino]acetyl]-methylamino]ethyl-methylcarbamoyl]oxy-5-hydroxy-2,5,7-trimethyl-4-oxospiro[1H-indene-6,1'-cyclopropane]-2-yl]methyl acetate |
|---|---|
| PubChem CID | 177277874 |
| Molecular Formula | C28H39N7O9 |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | [1-[2-[[2-[[2-[(2-azidoacetyl)amino]acetyl]amino]acetyl]-methylamino]ethyl-methylcarbamoyl]oxy-5-hydroxy-2,5,7-trimethyl-4-oxospiro[1H-indene-6,1'-cyclopropane]-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1(C)C=C2C(=O)C(C)(O)C3(CC3)C(C)=C2C1OC(=O)N(C)CCN(C)C(=O)CNC(=O)CNC(=O)CN=[N+]=[N-] |
| InChI | InChI=1S/C28H39N7O9/c1-16-22-18(23(40)27(4,42)28(16)7-8-28)11-26(3,15-43-17(2)36)24(22)44-25(41)35(6)10-9-34(5)21(39)14-31-19(37)12-30-20(38)13-32-33-29/h11,24,42H,7-10,12-15H2,1-6H3,(H,30,38)(H,31,37) |
| InChIKey | AYVHISYEDSGUKL-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 220.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|