C28H31ClN6O7 — CID 177277939
(2S)-N-[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-1-[(2S)-2-[(2-chloroacetyl)amino]-3-(4-hydroxy-3-nitrophenyl)propanoyl]piperidine-2-carboxamide (PubChem CID 177277939) has the molecular formula C28H31ClN6O7 and a molecular weight of 599.04 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-1-[(2S)-2-[(2-chloroacetyl)amino]-3-(4-hydroxy-3-nitrophenyl)propanoyl]piperidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-1-[(2S)-2-[(2-chloroacetyl)amino]-3-(4-hydroxy-3-nitrophenyl)propanoyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 177277939 |
| Molecular Formula | C28H31ClN6O7 |
| Molecular Weight | 599.04 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | (2S)-N-[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-1-[(2S)-2-[(2-chloroacetyl)amino]-3-(4-hydroxy-3-nitrophenyl)propanoyl]piperidine-2-carboxamide |
| SMILES | NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H]1CCCCN1C(=O)[C@H](Cc1ccc(O)c([N+](=O)[O-])c1)NC(=O)CCl |
| InChI | InChI=1S/C28H31ClN6O7/c29-14-25(37)32-21(11-16-8-9-24(36)23(12-16)35(41)42)28(40)34-10-4-3-7-22(34)27(39)33-20(26(30)38)13-17-15-31-19-6-2-1-5-18(17)19/h1-2,5-6,8-9,12,15,20-22,31,36H,3-4,7,10-11,13-14H2,(H2,30,38)(H,32,37)(H,33,39)/t20-,21-,22-/m0/s1 |
| InChIKey | CBODHWVJVJJEEA-FKBYEOEOSA-N |
| XLogP | 1.64 |
| TPSA | 200.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.04 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|