C16H19ClN2O4S — CID 177279796
(2S)-2-amino-3-[2-methyl-5-(phenylsulfamoyl)phenyl]propanoic acid;hydrochloride (PubChem CID 177279796) has the molecular formula C16H19ClN2O4S and a molecular weight of 370.86 g/mol. Its IUPAC name is (2S)-2-amino-3-[2-methyl-5-(phenylsulfamoyl)phenyl]propanoic acid;hydrochloride.
| Compound Name | (2S)-2-amino-3-[2-methyl-5-(phenylsulfamoyl)phenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 177279796 |
| Molecular Formula | C16H19ClN2O4S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | (2S)-2-amino-3-[2-methyl-5-(phenylsulfamoyl)phenyl]propanoic acid;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2)cc1C[C@H](N)C(=O)O.Cl |
| InChI | InChI=1S/C16H18N2O4S.ClH/c1-11-7-8-14(9-12(11)10-15(17)16(19)20)23(21,22)18-13-5-3-2-4-6-13;/h2-9,15,18H,10,17H2,1H3,(H,19,20);1H/t15-;/m0./s1 |
| InChIKey | DGJXYJSPRWOBIG-RSAXXLAASA-N |
| XLogP | 2.17 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |