C23H38N2O6S — CID 177279834
tert-butyl (2S)-3-[5-(butylsulfamoyl)-2-methylphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 177279834) has the molecular formula C23H38N2O6S and a molecular weight of 470.63 g/mol. Its IUPAC name is tert-butyl (2S)-3-[5-(butylsulfamoyl)-2-methylphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | tert-butyl (2S)-3-[5-(butylsulfamoyl)-2-methylphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 177279834 |
| Molecular Formula | C23H38N2O6S |
| Molecular Weight | 470.63 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | tert-butyl (2S)-3-[5-(butylsulfamoyl)-2-methylphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCCCNS(=O)(=O)c1ccc(C)c(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H38N2O6S/c1-9-10-13-24-32(28,29)18-12-11-16(2)17(14-18)15-19(20(26)30-22(3,4)5)25-21(27)31-23(6,7)8/h11-12,14,19,24H,9-10,13,15H2,1-8H3,(H,25,27)/t19-/m0/s1 |
| InChIKey | OVOXFRCCLYYVGL-IBGZPJMESA-N |
| XLogP | 3.85 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|