C21H34N2O4 — CID 177279884
tert-butyl (2S)-3-(5-amino-2-propan-2-ylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 177279884) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is tert-butyl (2S)-3-(5-amino-2-propan-2-ylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | tert-butyl (2S)-3-(5-amino-2-propan-2-ylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 177279884 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | tert-butyl (2S)-3-(5-amino-2-propan-2-ylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)c1ccc(N)cc1C[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H34N2O4/c1-13(2)16-10-9-15(22)11-14(16)12-17(18(24)26-20(3,4)5)23-19(25)27-21(6,7)8/h9-11,13,17H,12,22H2,1-8H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | UUNATZSJGZVSCR-KRWDZBQOSA-N |
| XLogP | 4.17 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|