C23H25N3O2 — CID 177279997
(2R,5S)-N,3-dibenzyl-4-oxo-3,10-diazatricyclo[5.2.1.01,5]decane-2-carboxamide (PubChem CID 177279997) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2R,5S)-N,3-dibenzyl-4-oxo-3,10-diazatricyclo[5.2.1.01,5]decane-2-carboxamide.
| Compound Name | (2R,5S)-N,3-dibenzyl-4-oxo-3,10-diazatricyclo[5.2.1.01,5]decane-2-carboxamide |
|---|---|
| PubChem CID | 177279997 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (2R,5S)-N,3-dibenzyl-4-oxo-3,10-diazatricyclo[5.2.1.01,5]decane-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@@H]1N(Cc2ccccc2)C(=O)[C@H]2CC3CCC21N3 |
| InChI | InChI=1S/C23H25N3O2/c27-21(24-14-16-7-3-1-4-8-16)20-23-12-11-18(25-23)13-19(23)22(28)26(20)15-17-9-5-2-6-10-17/h1-10,18-20,25H,11-15H2,(H,24,27)/t18?,19-,20+,23?/m1/s1 |
| InChIKey | WRVBHOGNIRHQMI-XLLHFJCQSA-N |
| XLogP | 2.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |