C27H35F2N3O6 — CID 177280011
tert-butyl (1R,2S,5S)-2-[[(2S)-4-(2,4-difluorophenoxy)-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 177280011) has the molecular formula C27H35F2N3O6 and a molecular weight of 535.59 g/mol. Its IUPAC name is tert-butyl (1R,2S,5S)-2-[[(2S)-4-(2,4-difluorophenoxy)-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | tert-butyl (1R,2S,5S)-2-[[(2S)-4-(2,4-difluorophenoxy)-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 177280011 |
| Molecular Formula | C27H35F2N3O6 |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | tert-butyl (1R,2S,5S)-2-[[(2S)-4-(2,4-difluorophenoxy)-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)N[C@@H](CC1CCNC1=O)C(=O)COc1ccc(F)cc1F)C2(C)C |
| InChI | InChI=1S/C27H35F2N3O6/c1-26(2,3)38-25(36)32-12-16-21(27(16,4)5)22(32)24(35)31-18(10-14-8-9-30-23(14)34)19(33)13-37-20-7-6-15(28)11-17(20)29/h6-7,11,14,16,18,21-22H,8-10,12-13H2,1-5H3,(H,30,34)(H,31,35)/t14?,16-,18-,21-,22-/m0/s1 |
| InChIKey | PQAUULCETDQWES-SYGCQNSHSA-N |
| XLogP | 2.82 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |