About (2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine
(2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine (PubChem CID 177282034) has the molecular formula C8H15F4NO
and a molecular weight of 217.21 g/mol. Its IUPAC name is (2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine.
Molecular Properties
| Compound Name | (2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine |
| PubChem CID | 177282034 |
| Molecular Formula | C8H15F4NO |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine |
| SMILES | CC(C)C(F)(F)[C@@H](N)COC(C)(F)F |
| InChI | InChI=1S/C8H15F4NO/c1-5(2)8(11,12)6(13)4-14-7(3,9)10/h5-6H,4,13H2,1-3H3/t6-/m0/s1 |
| InChIKey | ONSGOPMWNISFET-LURJTMIESA-N |
| XLogP | 2.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine?
The IUPAC name of (2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine (CID 177282034) is (2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine.
What is the SMILES notation for (2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine?
The canonical SMILES for (2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine is CC(C)C(F)(F)[C@@H](N)COC(C)(F)F.
What is the InChIKey of (2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine?
The InChIKey is ONSGOPMWNISFET-LURJTMIESA-N. The full InChI is InChI=1S/C8H15F4NO/c1-5(2)8(11,12)6(13)4-14-7(3,9)10/h5-6H,4,13H2,1-3H3/t6-/m0/s1.
What are the key properties of (2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine?
(2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine has a molecular weight of 217.21 g/mol, XLogP of 2.23, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(1,1-difluoroethoxy)-3,3-difluoro-4-methylpentan-2-amine is sourced from PubChem (CID 177282034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).