C8H7F9O3 — CID 177282155
3-[2-[difluoro(1,1,2,2,2-pentafluoroethoxy)methoxy]-2,2-difluoroethoxy]prop-1-ene (PubChem CID 177282155) has the molecular formula C8H7F9O3 and a molecular weight of 322.12 g/mol. Its IUPAC name is 3-[2-[difluoro(1,1,2,2,2-pentafluoroethoxy)methoxy]-2,2-difluoroethoxy]prop-1-ene.
| Compound Name | 3-[2-[difluoro(1,1,2,2,2-pentafluoroethoxy)methoxy]-2,2-difluoroethoxy]prop-1-ene |
|---|---|
| PubChem CID | 177282155 |
| Molecular Formula | C8H7F9O3 |
| Molecular Weight | 322.12 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 3-[2-[difluoro(1,1,2,2,2-pentafluoroethoxy)methoxy]-2,2-difluoroethoxy]prop-1-ene |
| SMILES | C=CCOCC(F)(F)OC(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F9O3/c1-2-3-18-4-5(9,10)19-8(16,17)20-7(14,15)6(11,12)13/h2H,1,3-4H2 |
| InChIKey | IZHDWPSAFZWKCQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.12 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|