C24H20ClF2N3O6 — CID 177282428
3-[(19S)-7-chloro-19-ethyl-6,8-difluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]-2-hydroxy-2-methylpropanamide (PubChem CID 177282428) has the molecular formula C24H20ClF2N3O6 and a molecular weight of 519.89 g/mol. Its IUPAC name is 3-[(19S)-7-chloro-19-ethyl-6,8-difluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]-2-hydroxy-2-methylpropanamide.
| Compound Name | 3-[(19S)-7-chloro-19-ethyl-6,8-difluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 177282428 |
| Molecular Formula | C24H20ClF2N3O6 |
| Molecular Weight | 519.89 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 3-[(19S)-7-chloro-19-ethyl-6,8-difluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-10-yl]-2-hydroxy-2-methylpropanamide |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(Cl)c(F)c1c2CC(C)(O)C(N)=O |
| InChI | InChI=1S/C24H20ClF2N3O6/c1-3-24(35)12-4-15-19-10(7-30(15)20(31)11(12)8-36-22(24)33)9(6-23(2,34)21(28)32)16-14(29-19)5-13(26)17(25)18(16)27/h4-5,34-35H,3,6-8H2,1-2H3,(H2,28,32)/t23?,24-/m0/s1 |
| InChIKey | IAVDESBDAQSAHI-CGAIIQECSA-N |
| XLogP | 1.79 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.89 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|