About 2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol
2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol (PubChem CID 177282809) has the molecular formula C18H24FNO
and a molecular weight of 289.39 g/mol. Its IUPAC name is 2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol |
| PubChem CID | 177282809 |
| Molecular Formula | C18H24FNO |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol |
| SMILES | CC(C)c1cc2ccc(C(C)(C)O)nc2c(C(C)C)c1F |
| InChI | InChI=1S/C18H24FNO/c1-10(2)13-9-12-7-8-14(18(5,6)21)20-17(12)15(11(3)4)16(13)19/h7-11,21H,1-6H3 |
| InChIKey | KUENJVFDQLUPIV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol?
The IUPAC name of 2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol (CID 177282809) is 2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol.
What is the SMILES notation for 2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol?
The canonical SMILES for 2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol is CC(C)c1cc2ccc(C(C)(C)O)nc2c(C(C)C)c1F.
What is the InChIKey of 2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol?
The InChIKey is KUENJVFDQLUPIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24FNO/c1-10(2)13-9-12-7-8-14(18(5,6)21)20-17(12)15(11(3)4)16(13)19/h7-11,21H,1-6H3.
What are the key properties of 2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol?
2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol has a molecular weight of 289.39 g/mol, XLogP of 4.85, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-fluoro-6,8-di(propan-2-yl)quinolin-2-yl]propan-2-ol is sourced from PubChem (CID 177282809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).