C17H24N2 — CID 177282930
N,N-dimethyl-6,8-di(propan-2-yl)quinolin-2-amine (PubChem CID 177282930) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N,N-dimethyl-6,8-di(propan-2-yl)quinolin-2-amine.
| Compound Name | N,N-dimethyl-6,8-di(propan-2-yl)quinolin-2-amine |
|---|---|
| PubChem CID | 177282930 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N,N-dimethyl-6,8-di(propan-2-yl)quinolin-2-amine |
| SMILES | CC(C)c1cc(C(C)C)c2nc(N(C)C)ccc2c1 |
| InChI | InChI=1S/C17H24N2/c1-11(2)14-9-13-7-8-16(19(5)6)18-17(13)15(10-14)12(3)4/h7-12H,1-6H3 |
| InChIKey | OSVSMIBHMSSZME-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |