C18H16N6OS — CID 177283645
5-amino-6-(5-methyl-1H-indazol-4-yl)-2-(4-methylthiophen-2-yl)pyrimidine-4-carboxamide (PubChem CID 177283645) has the molecular formula C18H16N6OS and a molecular weight of 364.43 g/mol. Its IUPAC name is 5-amino-6-(5-methyl-1H-indazol-4-yl)-2-(4-methylthiophen-2-yl)pyrimidine-4-carboxamide.
| Compound Name | 5-amino-6-(5-methyl-1H-indazol-4-yl)-2-(4-methylthiophen-2-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 177283645 |
| Molecular Formula | C18H16N6OS |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 5-amino-6-(5-methyl-1H-indazol-4-yl)-2-(4-methylthiophen-2-yl)pyrimidine-4-carboxamide |
| SMILES | Cc1csc(-c2nc(C(N)=O)c(N)c(-c3c(C)ccc4[nH]ncc34)n2)c1 |
| InChI | InChI=1S/C18H16N6OS/c1-8-5-12(26-7-8)18-22-15(14(19)16(23-18)17(20)25)13-9(2)3-4-11-10(13)6-21-24-11/h3-7H,19H2,1-2H3,(H2,20,25)(H,21,24) |
| InChIKey | BQICLVFEVKLPRV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |