About 2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol
2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol (PubChem CID 177283929) has the molecular formula C16H23NO
and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol.
Molecular Properties
| Compound Name | 2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol |
| PubChem CID | 177283929 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol |
| SMILES | CC(C)(C)c1ccc2c(n1)C(C)(O)C1(CC2)CC1 |
| InChI | InChI=1S/C16H23NO/c1-14(2,3)12-6-5-11-7-8-16(9-10-16)15(4,18)13(11)17-12/h5-6,18H,7-10H2,1-4H3 |
| InChIKey | UWDOWHKLGUKYFP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol?
The IUPAC name of 2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol (CID 177283929) is 2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol.
What is the SMILES notation for 2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol?
The canonical SMILES for 2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol is CC(C)(C)c1ccc2c(n1)C(C)(O)C1(CC2)CC1.
What is the InChIKey of 2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol?
The InChIKey is UWDOWHKLGUKYFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO/c1-14(2,3)12-6-5-11-7-8-16(9-10-16)15(4,18)13(11)17-12/h5-6,18H,7-10H2,1-4H3.
What are the key properties of 2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol?
2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol has a molecular weight of 245.37 g/mol, XLogP of 3.31, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-8-methylspiro[5,6-dihydroquinoline-7,1'-cyclopropane]-8-ol is sourced from PubChem (CID 177283929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).