C27H21N3P+ — CID 177284190
1H-indol-4-yl-diphenyl-(1H-pyrrolo[3,4-c]pyridin-4-yl)phosphanium (PubChem CID 177284190) has the molecular formula C27H21N3P+ and a molecular weight of 418.46 g/mol. Its IUPAC name is 1H-indol-4-yl-diphenyl-(1H-pyrrolo[3,4-c]pyridin-4-yl)phosphanium.
| Compound Name | 1H-indol-4-yl-diphenyl-(1H-pyrrolo[3,4-c]pyridin-4-yl)phosphanium |
|---|---|
| PubChem CID | 177284190 |
| Molecular Formula | C27H21N3P+ |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1H-indol-4-yl-diphenyl-(1H-pyrrolo[3,4-c]pyridin-4-yl)phosphanium |
| SMILES | C1=NCc2ccnc([P+](c3ccccc3)(c3ccccc3)c3cccc4[nH]ccc34)c21 |
| InChI | InChI=1S/C27H21N3P/c1-3-8-21(9-4-1)31(22-10-5-2-6-11-22,26-13-7-12-25-23(26)15-17-29-25)27-24-19-28-18-20(24)14-16-30-27/h1-17,19,29H,18H2/q+1 |
| InChIKey | ODCQSYWLXRPRJD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|