C20H20F4N4O3 — CID 177284354
7-(8-fluoro-3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-5,5-dimethyl-4-(2,2,2-trifluoroethylamino)pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 177284354) has the molecular formula C20H20F4N4O3 and a molecular weight of 440.40 g/mol. Its IUPAC name is 7-(8-fluoro-3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-5,5-dimethyl-4-(2,2,2-trifluoroethylamino)pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 7-(8-fluoro-3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-5,5-dimethyl-4-(2,2,2-trifluoroethylamino)pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 177284354 |
| Molecular Formula | C20H20F4N4O3 |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 7-(8-fluoro-3,4-dihydro-2H-chromen-6-yl)-2-(hydroxymethyl)-5,5-dimethyl-4-(2,2,2-trifluoroethylamino)pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(C)C(=O)N(c2cc(F)c3c(c2)CCCO3)c2nc(CO)nc(NCC(F)(F)F)c21 |
| InChI | InChI=1S/C20H20F4N4O3/c1-19(2)14-16(25-9-20(22,23)24)26-13(8-29)27-17(14)28(18(19)30)11-6-10-4-3-5-31-15(10)12(21)7-11/h6-7,29H,3-5,8-9H2,1-2H3,(H,25,26,27) |
| InChIKey | PQDBCLHWMYYOEM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |