About [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate
[5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate (PubChem CID 177284567) has the molecular formula C22H20FN5O2
and a molecular weight of 405.43 g/mol. Its IUPAC name is [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate.
Molecular Properties
| Compound Name | [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate |
| PubChem CID | 177284567 |
| Molecular Formula | C22H20FN5O2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate |
| SMILES | [H]/N=C(/OCc1ncc(C#N)c(Nc2ccc(Oc3ccccc3)cc2)c1F)N(C)C |
| InChI | InChI=1S/C22H20FN5O2/c1-28(2)22(25)29-14-19-20(23)21(15(12-24)13-26-19)27-16-8-10-18(11-9-16)30-17-6-4-3-5-7-17/h3-11,13,25H,14H2,1-2H3,(H,26,27)/b25-22+ |
| InChIKey | SYIQJDJSEJQVAV-YYDJUVGSSA-N |
| XLogP | 4.64 |
| TPSA | 94.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate?
The IUPAC name of [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate (CID 177284567) is [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate.
What is the SMILES notation for [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate?
The canonical SMILES for [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate is [H]/N=C(/OCc1ncc(C#N)c(Nc2ccc(Oc3ccccc3)cc2)c1F)N(C)C.
What is the InChIKey of [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate?
The InChIKey is SYIQJDJSEJQVAV-YYDJUVGSSA-N. The full InChI is InChI=1S/C22H20FN5O2/c1-28(2)22(25)29-14-19-20(23)21(15(12-24)13-26-19)27-16-8-10-18(11-9-16)30-17-6-4-3-5-7-17/h3-11,13,25H,14H2,1-2H3,(H,26,27)/b25-22+.
What are the key properties of [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate?
[5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate has a molecular weight of 405.43 g/mol, XLogP of 4.64, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate is sourced from PubChem (CID 177284567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).