C22H20FN5O2 — CID 177284567
[5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate (PubChem CID 177284567) has the molecular formula C22H20FN5O2 and a molecular weight of 405.43 g/mol. Its IUPAC name is [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate.
| Compound Name | [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate |
|---|---|
| PubChem CID | 177284567 |
| Molecular Formula | C22H20FN5O2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [5-cyano-3-fluoro-4-(4-phenoxyanilino)-2-pyridinyl]methyl N,N-dimethylcarbamimidate |
| SMILES | [H]/N=C(/OCc1ncc(C#N)c(Nc2ccc(Oc3ccccc3)cc2)c1F)N(C)C |
| InChI | InChI=1S/C22H20FN5O2/c1-28(2)22(25)29-14-19-20(23)21(15(12-24)13-26-19)27-16-8-10-18(11-9-16)30-17-6-4-3-5-7-17/h3-11,13,25H,14H2,1-2H3,(H,26,27)/b25-22+ |
| InChIKey | SYIQJDJSEJQVAV-YYDJUVGSSA-N |
| XLogP | 4.64 |
| TPSA | 94.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|