C25H26F3N5O3 — CID 177284843
[8-(4-phenoxyphenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-yl]methyl N-propan-2-yl-N-(2,2,2-trifluoroethyl)carbamimidate (PubChem CID 177284843) has the molecular formula C25H26F3N5O3 and a molecular weight of 501.51 g/mol. Its IUPAC name is [8-(4-phenoxyphenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-yl]methyl N-propan-2-yl-N-(2,2,2-trifluoroethyl)carbamimidate.
| Compound Name | [8-(4-phenoxyphenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-yl]methyl N-propan-2-yl-N-(2,2,2-trifluoroethyl)carbamimidate |
|---|---|
| PubChem CID | 177284843 |
| Molecular Formula | C25H26F3N5O3 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | [8-(4-phenoxyphenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-yl]methyl N-propan-2-yl-N-(2,2,2-trifluoroethyl)carbamimidate |
| SMILES | [H]/N=C(/OCc1ncc2c(n1)N(c1ccc(Oc3ccccc3)cc1)CCO2)N(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C25H26F3N5O3/c1-17(2)33(16-25(26,27)28)24(29)35-15-22-30-14-21-23(31-22)32(12-13-34-21)18-8-10-20(11-9-18)36-19-6-4-3-5-7-19/h3-11,14,17,29H,12-13,15-16H2,1-2H3/b29-24+ |
| InChIKey | BFLSENOTUFWDQM-RMLRFSFXSA-N |
| XLogP | 5.52 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|