C17H19N7O — CID 177284860
[4-amino-6-(naphthalen-2-ylamino)-1,3,5-triazin-2-yl]methyl N,N-dimethylcarbamimidate (PubChem CID 177284860) has the molecular formula C17H19N7O and a molecular weight of 337.39 g/mol. Its IUPAC name is [4-amino-6-(naphthalen-2-ylamino)-1,3,5-triazin-2-yl]methyl N,N-dimethylcarbamimidate.
| Compound Name | [4-amino-6-(naphthalen-2-ylamino)-1,3,5-triazin-2-yl]methyl N,N-dimethylcarbamimidate |
|---|---|
| PubChem CID | 177284860 |
| Molecular Formula | C17H19N7O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | [4-amino-6-(naphthalen-2-ylamino)-1,3,5-triazin-2-yl]methyl N,N-dimethylcarbamimidate |
| SMILES | [H]/N=C(/OCc1nc(N)nc(Nc2ccc3ccccc3c2)n1)N(C)C |
| InChI | InChI=1S/C17H19N7O/c1-24(2)16(19)25-10-14-21-15(18)23-17(22-14)20-13-8-7-11-5-3-4-6-12(11)9-13/h3-9,19H,10H2,1-2H3,(H3,18,20,21,22,23)/b19-16+ |
| InChIKey | WHHBWNJVPPMWIR-KNTRCKAVSA-N |
| XLogP | 2.36 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|