C12H16O3 — CID 177285092
(2R,3aR)-2-prop-2-ynoxy-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylic acid (PubChem CID 177285092) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2R,3aR)-2-prop-2-ynoxy-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylic acid.
| Compound Name | (2R,3aR)-2-prop-2-ynoxy-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylic acid |
|---|---|
| PubChem CID | 177285092 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2R,3aR)-2-prop-2-ynoxy-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylic acid |
| SMILES | C#CCO[C@@H]1CC2CCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C12H16O3/c1-2-6-15-10-7-9-4-3-5-12(9,8-10)11(13)14/h1,9-10H,3-8H2,(H,13,14)/t9?,10-,12-/m1/s1 |
| InChIKey | GSLAEHHUAZZDQP-GTFYECCDSA-N |
| XLogP | 1.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|