C43H54IrN3O2S- — CID 177286163
4-(8-tert-butyl-2-methyl-5H-quinolin-5-id-6-yl)-7-(cyclopentylmethyl)-[1]benzothiolo[3,2-d]pyrimidine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 177286163) has the molecular formula C43H54IrN3O2S- and a molecular weight of 869.21 g/mol. Its IUPAC name is 4-(8-tert-butyl-2-methyl-5H-quinolin-5-id-6-yl)-7-(cyclopentylmethyl)-[1]benzothiolo[3,2-d]pyrimidine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 4-(8-tert-butyl-2-methyl-5H-quinolin-5-id-6-yl)-7-(cyclopentylmethyl)-[1]benzothiolo[3,2-d]pyrimidine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 177286163 |
| Molecular Formula | C43H54IrN3O2S- |
| Molecular Weight | 869.21 g/mol |
| Exact Mass | 869.36 |
| IUPAC Name | 4-(8-tert-butyl-2-methyl-5H-quinolin-5-id-6-yl)-7-(cyclopentylmethyl)-[1]benzothiolo[3,2-d]pyrimidine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1ccc2[c-]c(-c3ncnc4c3sc3cc(CC5CCCC5)ccc34)cc(C(C)(C)C)c2n1.[Ir] |
| InChI | InChI=1S/C30H30N3S.C13H24O2.Ir/c1-18-9-11-21-15-22(16-24(26(21)33-18)30(2,3)4)27-29-28(32-17-31-27)23-12-10-20(14-25(23)34-29)13-19-7-5-6-8-19;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h9-12,14,16-17,19H,5-8,13H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | KNZLEQXMHYNBIP-DZTQYQPZSA-N |
| XLogP | 12.07 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.21 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|