About [2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate
[2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate (PubChem CID 177288016) has the molecular formula C15H11F5O5S
and a molecular weight of 398.31 g/mol. Its IUPAC name is [2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate.
Molecular Properties
| Compound Name | [2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate |
| PubChem CID | 177288016 |
| Molecular Formula | C15H11F5O5S |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | [2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate |
| SMILES | O=Cc1ccc(OCC(=O)Oc2ccccc2OS(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C15H11F5O5S/c16-26(17,18,19,20)25-14-4-2-1-3-13(14)24-15(22)10-23-12-7-5-11(9-21)6-8-12/h1-9H,10H2 |
| InChIKey | SZIULZVMDTZAGO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate?
The IUPAC name of [2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate (CID 177288016) is [2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate.
What is the SMILES notation for [2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate?
The canonical SMILES for [2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate is O=Cc1ccc(OCC(=O)Oc2ccccc2OS(F)(F)(F)(F)F)cc1.
What is the InChIKey of [2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate?
The InChIKey is SZIULZVMDTZAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F5O5S/c16-26(17,18,19,20)25-14-4-2-1-3-13(14)24-15(22)10-23-12-7-5-11(9-21)6-8-12/h1-9H,10H2.
What are the key properties of [2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate?
[2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate has a molecular weight of 398.31 g/mol, XLogP of 5.08, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(pentafluoro-λ6-sulfanyl)oxyphenyl] 2-(4-formylphenoxy)acetate is sourced from PubChem (CID 177288016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).